C22H24N6O2 — CID 55705512
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide (PubChem CID 55705512) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 55705512 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H24N6O2/c1-15-19(16(2)28(26-15)18-7-4-3-5-8-18)20(29)21(30)25-17-9-13-27(14-10-17)22-23-11-6-12-24-22/h3-8,11-12,17H,9-10,13-14H2,1-2H3,(H,25,30) |
| InChIKey | INDJNMUIEOFCEO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|