C19H21N3O3 — CID 111661330
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-oxoacetamide (PubChem CID 111661330) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-oxoacetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 111661330 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-17(13(2)22(21-12)16-6-4-3-5-7-16)18(24)19(25)20-15-9-8-14(10-15)11-23/h3-9,14-15,23H,10-11H2,1-2H3,(H,20,25)/t14-,15+/m0/s1 |
| InChIKey | NVXNVQQCXUWTMK-LSDHHAIUSA-N |
| XLogP | 1.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|