C17H18N2O — CID 927987
phenyl-[(2S,4R)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone (PubChem CID 927987) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is phenyl-[(2S,4R)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone.
| Compound Name | phenyl-[(2S,4R)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone |
|---|---|
| PubChem CID | 927987 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | phenyl-[(2S,4R)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone |
| SMILES | Cc1nn(C(=O)c2ccccc2)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C17H18N2O/c1-10-14-13(9-12-15(14)17(12,2)3)19(18-10)16(20)11-7-5-4-6-8-11/h4-8,12,15H,9H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | PFTFUPLYGXJWEO-IUODEOHRSA-N |
| XLogP | 3.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |