C21H24N2O3 — CID 163084510
3-(2,4-dimethoxyphenyl)-1-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]prop-2-en-1-one (PubChem CID 163084510) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]prop-2-en-1-one.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163084510 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)n2nc(C)c3c2C[C@H]2[C@H]3C2(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-12-19-16(11-15-20(19)21(15,2)3)23(22-12)18(24)9-7-13-6-8-14(25-4)10-17(13)26-5/h6-10,15,20H,11H2,1-5H3/t15-,20+/m0/s1 |
| InChIKey | HDECDSQRXVXTEG-MGPUTAFESA-N |
| XLogP | 3.86 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|