C21H22O3S — CID 59593512
(E)-3-(4-hydroxy-2-methoxyphenyl)-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one (PubChem CID 59593512) has the molecular formula C21H22O3S and a molecular weight of 354.47 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-2-methoxyphenyl)-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxy-2-methoxyphenyl)-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59593512 |
| Molecular Formula | C21H22O3S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (E)-3-(4-hydroxy-2-methoxyphenyl)-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one |
| SMILES | COc1cc(O)ccc1/C=C/C(=O)c1sc(C)c2c1C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C21H22O3S/c1-11-18-14(10-15-19(18)21(15,2)3)20(25-11)16(23)8-6-12-5-7-13(22)9-17(12)24-4/h5-9,15,19,22H,10H2,1-4H3/b8-6+/t15-,19-/m1/s1 |
| InChIKey | HDJMJZHNZDNVIU-ZUWQMALMSA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|