C21H20O3S — CID 67415507
4-[3-oxo-3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-1-enyl]benzoic acid (PubChem CID 67415507) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[3-oxo-3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-1-enyl]benzoic acid.
| Compound Name | 4-[3-oxo-3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 67415507 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[3-oxo-3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-1-enyl]benzoic acid |
| SMILES | Cc1sc(C(=O)C=Cc2ccc(C(=O)O)cc2)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C21H20O3S/c1-11-17-14(10-15-18(17)21(15,2)3)19(25-11)16(22)9-6-12-4-7-13(8-5-12)20(23)24/h4-9,15,18H,10H2,1-3H3,(H,23,24)/t15-,18-/m1/s1 |
| InChIKey | IBWPQPTUHUDYCD-CRAIPNDOSA-N |
| XLogP | 4.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|