C22H25NOS — CID 59593506
(E)-3-[4-(dimethylamino)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one (PubChem CID 59593506) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59593506 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]prop-2-en-1-one |
| SMILES | Cc1sc(C(=O)/C=C/c2ccc(N(C)C)cc2)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C22H25NOS/c1-13-19-16(12-17-20(19)22(17,2)3)21(25-13)18(24)11-8-14-6-9-15(10-7-14)23(4)5/h6-11,17,20H,12H2,1-5H3/b11-8+/t17-,20-/m1/s1 |
| InChIKey | NECHHFQTNHUANT-JTMFDWDJSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|