C11H18INS — CID 142019166
methyl-[(E)-4-methyl-5-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)pent-4-enylidene]-λ3-iodane (PubChem CID 142019166) has the molecular formula C11H18INS and a molecular weight of 323.24 g/mol. Its IUPAC name is methyl-[(E)-4-methyl-5-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)pent-4-enylidene]-λ3-iodane.
| Compound Name | methyl-[(E)-4-methyl-5-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)pent-4-enylidene]-λ3-iodane |
|---|---|
| PubChem CID | 142019166 |
| Molecular Formula | C11H18INS |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | methyl-[(E)-4-methyl-5-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)pent-4-enylidene]-λ3-iodane |
| SMILES | C/I=C/CC/C(C)=C/C1=CSC(C)N1 |
| InChI | InChI=1S/C11H18INS/c1-9(5-4-6-12-3)7-11-8-14-10(2)13-11/h6-8,10,13H,4-5H2,1-3H3/b9-7+ |
| InChIKey | XVVWGADZVGSQSC-VQHVLOKHSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|