C29H43FO3S — CID 142019843
(1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-methyl-4-methylidenecyclohexan-1-ol (PubChem CID 142019843) has the molecular formula C29H43FO3S and a molecular weight of 490.73 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-methyl-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-methyl-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 142019843 |
| Molecular Formula | C29H43FO3S |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-methyl-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C([C@H](C)C/C=C(\F)S(=O)(=O)C(C)(C)C)=CC[C@@H]23)C[C@@H](O)CC1C |
| InChI | InChI=1S/C29H43FO3S/c1-19(10-15-27(30)34(32,33)28(4,5)6)25-13-14-26-22(9-8-16-29(25,26)7)11-12-23-18-24(31)17-20(2)21(23)3/h11-13,15,19-20,24,26,31H,3,8-10,14,16-18H2,1-2,4-7H3/b22-11+,23-12-,27-15+/t19-,20?,24+,26+,29?/m1/s1 |
| InChIKey | AFGTVKBZPKCVDI-JMLIXLRYSA-N |
| XLogP | 7.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|