C11H19N — CID 142020306
N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine (PubChem CID 142020306) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine.
| Compound Name | N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine |
|---|---|
| PubChem CID | 142020306 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine |
| SMILES | C=CC(C)C(C=C)/N=C(\C)CC |
| InChI | InChI=1S/C11H19N/c1-6-9(4)11(8-3)12-10(5)7-2/h6,8-9,11H,1,3,7H2,2,4-5H3/b12-10+ |
| InChIKey | OWNANHGNGJSRKX-ZRDIBKRKSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|