About N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine
N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine (PubChem CID 142020306) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine.
Molecular Properties
| Compound Name | N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine |
| PubChem CID | 142020306 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine |
| SMILES | C=CC(C)C(C=C)/N=C(\C)CC |
| InChI | InChI=1S/C11H19N/c1-6-9(4)11(8-3)12-10(5)7-2/h6,8-9,11H,1,3,7H2,2,4-5H3/b12-10+ |
| InChIKey | OWNANHGNGJSRKX-ZRDIBKRKSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine?
The IUPAC name of N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine (CID 142020306) is N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine.
What is the SMILES notation for N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine?
The canonical SMILES for N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine is C=CC(C)C(C=C)/N=C(\C)CC.
What is the InChIKey of N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine?
The InChIKey is OWNANHGNGJSRKX-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H19N/c1-6-9(4)11(8-3)12-10(5)7-2/h6,8-9,11H,1,3,7H2,2,4-5H3/b12-10+.
What are the key properties of N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine?
N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine has a molecular weight of 165.28 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylhexa-1,5-dien-3-yl)butan-2-imine is sourced from PubChem (CID 142020306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).