C9H16N2 — CID 123748386
3-N-but-3-en-2-yl-2-N-methylbutane-2,3-diimine (PubChem CID 123748386) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-N-but-3-en-2-yl-2-N-methylbutane-2,3-diimine.
| Compound Name | 3-N-but-3-en-2-yl-2-N-methylbutane-2,3-diimine |
|---|---|
| PubChem CID | 123748386 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-N-but-3-en-2-yl-2-N-methylbutane-2,3-diimine |
| SMILES | C=CC(C)/N=C(C)/C(C)=N/C |
| InChI | InChI=1S/C9H16N2/c1-6-7(2)11-9(4)8(3)10-5/h6-7H,1H2,2-5H3/b10-8+,11-9+ |
| InChIKey | MEXONRLROGTGHU-GFULKKFKSA-N |
| XLogP | 2.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|