C19H27N3 — CID 142020526
4-(3-benzyl-1-ethylpyrazol-5-yl)-1-ethylpiperidine (PubChem CID 142020526) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 4-(3-benzyl-1-ethylpyrazol-5-yl)-1-ethylpiperidine.
| Compound Name | 4-(3-benzyl-1-ethylpyrazol-5-yl)-1-ethylpiperidine |
|---|---|
| PubChem CID | 142020526 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 4-(3-benzyl-1-ethylpyrazol-5-yl)-1-ethylpiperidine |
| SMILES | CCN1CCC(c2cc(Cc3ccccc3)nn2CC)CC1 |
| InChI | InChI=1S/C19H27N3/c1-3-21-12-10-17(11-13-21)19-15-18(20-22(19)4-2)14-16-8-6-5-7-9-16/h5-9,15,17H,3-4,10-14H2,1-2H3 |
| InChIKey | AHFWPSFBWYFWTK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |