C11H15N3 — CID 142023174
1-pentylimidazo[4,5-c]pyridine (PubChem CID 142023174) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-pentylimidazo[4,5-c]pyridine.
| Compound Name | 1-pentylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 142023174 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-pentylimidazo[4,5-c]pyridine |
| SMILES | CCCCCn1cnc2cnccc21 |
| InChI | InChI=1S/C11H15N3/c1-2-3-4-7-14-9-13-10-8-12-6-5-11(10)14/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | ZPHKOUVIJLFGMI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|