About 7-butylpurine
7-butylpurine (PubChem CID 54540846) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-butylpurine.
Molecular Properties
| Compound Name | 7-butylpurine |
| PubChem CID | 54540846 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 7-butylpurine |
| SMILES | CCCCn1cnc2ncncc21 |
| InChI | InChI=1S/C9H12N4/c1-2-3-4-13-7-12-9-8(13)5-10-6-11-9/h5-7H,2-4H2,1H3 |
| InChIKey | RUTMAIVZDVDBTL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-butylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butylpurine?
The IUPAC name of 7-butylpurine (CID 54540846) is 7-butylpurine.
What is the SMILES notation for 7-butylpurine?
The canonical SMILES for 7-butylpurine is CCCCn1cnc2ncncc21.
What is the InChIKey of 7-butylpurine?
The InChIKey is RUTMAIVZDVDBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-2-3-4-13-7-12-9-8(13)5-10-6-11-9/h5-7H,2-4H2,1H3.
What are the key properties of 7-butylpurine?
7-butylpurine has a molecular weight of 176.22 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butylpurine is sourced from PubChem (CID 54540846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).