C28H46O — CID 142023260
(3S,10R,17E)-17-(5-ethyl-6-methylheptan-2-ylidene)-10-methyl-2,3,4,7,8,9,11,12,13,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142023260) has the molecular formula C28H46O and a molecular weight of 398.68 g/mol. Its IUPAC name is (3S,10R,17E)-17-(5-ethyl-6-methylheptan-2-ylidene)-10-methyl-2,3,4,7,8,9,11,12,13,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,17E)-17-(5-ethyl-6-methylheptan-2-ylidene)-10-methyl-2,3,4,7,8,9,11,12,13,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142023260 |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | (3S,10R,17E)-17-(5-ethyl-6-methylheptan-2-ylidene)-10-methyl-2,3,4,7,8,9,11,12,13,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(CC/C(C)=C1\CCC2C1CCC1C2CC=C2C[C@@H](O)CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C28H46O/c1-6-20(18(2)3)8-7-19(4)23-11-12-25-24(23)13-14-27-26(25)10-9-21-17-22(29)15-16-28(21,27)5/h9,18,20,22,24-27,29H,6-8,10-17H2,1-5H3/b23-19+/t20?,22-,24?,25?,26?,27?,28-/m0/s1 |
| InChIKey | YLDWKNLONYYFKF-HYKOAUNQSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|