C24H28O6S2 — CID 14202336
[(2E)-5,5-bis-(4-methylphenyl)sulfonylocta-2,7-dienyl] acetate (PubChem CID 14202336) has the molecular formula C24H28O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(2E)-5,5-bis-(4-methylphenyl)sulfonylocta-2,7-dienyl] acetate.
| Compound Name | [(2E)-5,5-bis-(4-methylphenyl)sulfonylocta-2,7-dienyl] acetate |
|---|---|
| PubChem CID | 14202336 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(2E)-5,5-bis-(4-methylphenyl)sulfonylocta-2,7-dienyl] acetate |
| SMILES | C=CCC(C/C=C/COC(C)=O)(S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28O6S2/c1-5-16-24(17-6-7-18-30-21(4)25,31(26,27)22-12-8-19(2)9-13-22)32(28,29)23-14-10-20(3)11-15-23/h5-15H,1,16-18H2,2-4H3/b7-6+ |
| InChIKey | VXXLOWUXYNTZPS-VOTSOKGWSA-N |
| XLogP | 4.33 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|