C25H26O3 — CID 142024839
4-[3-methoxy-1-(5-phenylmethoxycyclohepta-1,4,6-trien-1-yl)but-3-en-2-yl]phenol (PubChem CID 142024839) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[3-methoxy-1-(5-phenylmethoxycyclohepta-1,4,6-trien-1-yl)but-3-en-2-yl]phenol.
| Compound Name | 4-[3-methoxy-1-(5-phenylmethoxycyclohepta-1,4,6-trien-1-yl)but-3-en-2-yl]phenol |
|---|---|
| PubChem CID | 142024839 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-[3-methoxy-1-(5-phenylmethoxycyclohepta-1,4,6-trien-1-yl)but-3-en-2-yl]phenol |
| SMILES | C=C(OC)C(CC1=CCC=C(OCc2ccccc2)C=C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H26O3/c1-19(27-2)25(22-12-14-23(26)15-13-22)17-20-9-6-10-24(16-11-20)28-18-21-7-4-3-5-8-21/h3-5,7-16,25-26H,1,6,17-18H2,2H3 |
| InChIKey | RMNKYOPTVDDZCW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|