C15H17NO3 — CID 70316779
(2S)-2-amino-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 70316779) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2S)-2-amino-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)acetic acid.
| Compound Name | (2S)-2-amino-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 70316779 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2S)-2-amino-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | N[C@H](C(=O)O)C1C=CC(OCc2ccccc2)=CC1 |
| InChI | InChI=1S/C15H17NO3/c16-14(15(17)18)12-6-8-13(9-7-12)19-10-11-4-2-1-3-5-11/h1-6,8-9,12,14H,7,10,16H2,(H,17,18)/t12?,14-/m0/s1 |
| InChIKey | HMRLYBUTVDMTGZ-PYMCNQPYSA-N |
| XLogP | 2.08 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |