C25H36O4 — CID 123543546
1-[4-(2,5,5-trimethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyethyl 2-phenylethaneperoxoate (PubChem CID 123543546) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-[4-(2,5,5-trimethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyethyl 2-phenylethaneperoxoate.
| Compound Name | 1-[4-(2,5,5-trimethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyethyl 2-phenylethaneperoxoate |
|---|---|
| PubChem CID | 123543546 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[4-(2,5,5-trimethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyethyl 2-phenylethaneperoxoate |
| SMILES | CC(OOC(=O)Cc1ccccc1)OC1=CCC(C(CC(C)(C)C)C(C)C)C=C1 |
| InChI | InChI=1S/C25H36O4/c1-18(2)23(17-25(4,5)6)21-12-14-22(15-13-21)27-19(3)28-29-24(26)16-20-10-8-7-9-11-20/h7-12,14-15,18-19,21,23H,13,16-17H2,1-6H3 |
| InChIKey | ZIBOSRNUFPSFJA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|