C19H18F3N3OS — CID 142025380
[2-aminosulfanyl-5-[5-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanol (PubChem CID 142025380) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is [2-aminosulfanyl-5-[5-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanol.
| Compound Name | [2-aminosulfanyl-5-[5-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 142025380 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-aminosulfanyl-5-[5-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanol |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(SN)c(CO)c2)cc1C |
| InChI | InChI=1S/C19H18F3N3OS/c1-11-3-4-13(7-12(11)2)16-9-18(19(20,21)22)24-25(16)15-5-6-17(27-23)14(8-15)10-26/h3-9,26H,10,23H2,1-2H3 |
| InChIKey | AHTSKZXLZGBWPW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|