C20H19F3N2O — CID 18338144
5-(3-ethyl-4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole (PubChem CID 18338144) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is 5-(3-ethyl-4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-(3-ethyl-4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 18338144 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-(3-ethyl-4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole |
| SMILES | CCc1cc(-c2cc(C(F)(F)F)nn2-c2ccc(C)cc2)ccc1OC |
| InChI | InChI=1S/C20H19F3N2O/c1-4-14-11-15(7-10-18(14)26-3)17-12-19(20(21,22)23)24-25(17)16-8-5-13(2)6-9-16/h5-12H,4H2,1-3H3 |
| InChIKey | ADDYEGADBJFUSF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |