C32H53FO — CID 142025692
17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;3-methylbut-3-en-2-one (PubChem CID 142025692) has the molecular formula C32H53FO and a molecular weight of 472.77 g/mol. Its IUPAC name is 17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;3-methylbut-3-en-2-one.
| Compound Name | 17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 142025692 |
| Molecular Formula | C32H53FO |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.41 |
| IUPAC Name | 17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;3-methylbut-3-en-2-one |
| SMILES | C/C(=C\CCC(C)C1CCC2C3CCC4CCCCC4(C)C3CCC12C)CF.C=C(C)C(C)=O |
| InChI | InChI=1S/C27H45F.C5H8O/c1-19(18-28)8-7-9-20(2)23-13-14-24-22-12-11-21-10-5-6-16-26(21,3)25(22)15-17-27(23,24)4;1-4(2)5(3)6/h8,20-25H,5-7,9-18H2,1-4H3;1H2,2-3H3/b19-8+; |
| InChIKey | WJGSMSVVBPWIRI-BTSUEJIHSA-N |
| XLogP | 9.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|