About acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane
acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane (PubChem CID 142026196) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane.
Molecular Properties
| Compound Name | acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane |
| PubChem CID | 142026196 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane |
| SMILES | C#C.CC.CNC(CC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3.C2H6.C2H2/c1-7(12)6-8(11-5)9(13)14-10(2,3)4;2*1-2/h8,11H,6H2,1-5H3;1-2H3;1-2H |
| InChIKey | JGRQVUIGBZPFJN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane?
The IUPAC name of acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane (CID 142026196) is acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane.
What is the SMILES notation for acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane?
The canonical SMILES for acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane is C#C.CC.CNC(CC(C)=O)C(=O)OC(C)(C)C.
What is the InChIKey of acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane?
The InChIKey is JGRQVUIGBZPFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.C2H6.C2H2/c1-7(12)6-8(11-5)9(13)14-10(2,3)4;2*1-2/h8,11H,6H2,1-5H3;1-2H3;1-2H.
What are the key properties of acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane?
acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane has a molecular weight of 257.37 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;tert-butyl 2-(methylamino)-4-oxopentanoate;ethane is sourced from PubChem (CID 142026196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).