C37H28O2 — CID 142029099
21-ethynyl-10,18-dimethyl-5-(4-methylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-ol (PubChem CID 142029099) has the molecular formula C37H28O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 21-ethynyl-10,18-dimethyl-5-(4-methylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-ol.
| Compound Name | 21-ethynyl-10,18-dimethyl-5-(4-methylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-ol |
|---|---|
| PubChem CID | 142029099 |
| Molecular Formula | C37H28O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 21-ethynyl-10,18-dimethyl-5-(4-methylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-ol |
| SMILES | C#CC1(O)c2cc(C)ccc2-c2c1c1c(c3cc(C)ccc23)OC(c2ccccc2)(c2ccc(C)cc2)C=C1 |
| InChI | InChI=1S/C37H28O2/c1-5-36(38)32-22-25(4)14-18-29(32)33-28-17-13-24(3)21-31(28)35-30(34(33)36)19-20-37(39-35,26-9-7-6-8-10-26)27-15-11-23(2)12-16-27/h1,6-22,38H,2-4H3 |
| InChIKey | GZUUGCPQNFBGTA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|