C41H31BO2 — CID 174145271
CID 174145271 (PubChem CID 174145271) has the molecular formula C41H31BO2 and a molecular weight of 566.51 g/mol.
| Compound Name | CID 174145271 |
|---|---|
| PubChem CID | 174145271 |
| Molecular Formula | C41H31BO2 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c3c(c4c(c2c1)OC(c1ccc(O)cc1)(c1ccc(-c2ccccc2)cc1)C=C4)C(C)(C)c1cc(C)ccc1-3 |
| InChI | InChI=1S/C41H31BO2/c1-25-9-19-33-36(23-25)40(2,3)38-34-21-22-41(29-14-17-31(43)18-15-29,28-12-10-27(11-13-28)26-7-5-4-6-8-26)44-39(34)35-24-30(42)16-20-32(35)37(33)38/h4-24,43H,1-3H3 |
| InChIKey | DGGOPEAAEJQBRZ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|