C12H13F3N2O3 — CID 142031001
N-[4-ethyl-2-(2,2,2-trifluoroacetyl)phenyl]-2-(hydroxyamino)acetamide (PubChem CID 142031001) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-[4-ethyl-2-(2,2,2-trifluoroacetyl)phenyl]-2-(hydroxyamino)acetamide.
| Compound Name | N-[4-ethyl-2-(2,2,2-trifluoroacetyl)phenyl]-2-(hydroxyamino)acetamide |
|---|---|
| PubChem CID | 142031001 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[4-ethyl-2-(2,2,2-trifluoroacetyl)phenyl]-2-(hydroxyamino)acetamide |
| SMILES | CCc1ccc(NC(=O)CNO)c(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-2-7-3-4-9(17-10(18)6-16-20)8(5-7)11(19)12(13,14)15/h3-5,16,20H,2,6H2,1H3,(H,17,18) |
| InChIKey | SFQAEJIIRLEUQJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|