C21H31N3 — CID 142032908
2-N-[3-(1-benzylpiperidin-4-yl)propyl]cyclohexa-1,3-diene-1,2-diamine (PubChem CID 142032908) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-N-[3-(1-benzylpiperidin-4-yl)propyl]cyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 2-N-[3-(1-benzylpiperidin-4-yl)propyl]cyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 142032908 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 2-N-[3-(1-benzylpiperidin-4-yl)propyl]cyclohexa-1,3-diene-1,2-diamine |
| SMILES | NC1=C(NCCCC2CCN(Cc3ccccc3)CC2)C=CCC1 |
| InChI | InChI=1S/C21H31N3/c22-20-10-4-5-11-21(20)23-14-6-9-18-12-15-24(16-13-18)17-19-7-2-1-3-8-19/h1-3,5,7-8,11,18,23H,4,6,9-10,12-17,22H2 |
| InChIKey | ITRIZMUSKLXDJT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|