C36H51FN4O4S — CID 142033452
4-[1-ethyl-3-[(4-methylsulfonylphenyl)methyl]pyrazol-5-yl]-1-[[(2S)-2-(3-fluorophenyl)cyclopentyl]methyl]piperidine;3-methyl-2-(methylamino)butanoic acid (PubChem CID 142033452) has the molecular formula C36H51FN4O4S and a molecular weight of 654.89 g/mol. Its IUPAC name is 4-[1-ethyl-3-[(4-methylsulfonylphenyl)methyl]pyrazol-5-yl]-1-[[(2S)-2-(3-fluorophenyl)cyclopentyl]methyl]piperidine;3-methyl-2-(methylamino)butanoic acid.
| Compound Name | 4-[1-ethyl-3-[(4-methylsulfonylphenyl)methyl]pyrazol-5-yl]-1-[[(2S)-2-(3-fluorophenyl)cyclopentyl]methyl]piperidine;3-methyl-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 142033452 |
| Molecular Formula | C36H51FN4O4S |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.36 |
| IUPAC Name | 4-[1-ethyl-3-[(4-methylsulfonylphenyl)methyl]pyrazol-5-yl]-1-[[(2S)-2-(3-fluorophenyl)cyclopentyl]methyl]piperidine;3-methyl-2-(methylamino)butanoic acid |
| SMILES | CCn1nc(Cc2ccc(S(C)(=O)=O)cc2)cc1C1CCN(CC2CCC[C@@H]2c2cccc(F)c2)CC1.CNC(C(=O)O)C(C)C |
| InChI | InChI=1S/C30H38FN3O2S.C6H13NO2/c1-3-34-30(20-27(32-34)18-22-10-12-28(13-11-22)37(2,35)36)23-14-16-33(17-15-23)21-25-7-5-9-29(25)24-6-4-8-26(31)19-24;1-4(2)5(7-3)6(8)9/h4,6,8,10-13,19-20,23,25,29H,3,5,7,9,14-18,21H2,1-2H3;4-5,7H,1-3H3,(H,8,9)/t25?,29-;/m1./s1 |
| InChIKey | GVVWPJJSZWQFMV-BYNXYREKSA-N |
| XLogP | 6.11 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |