C20H30FNS — CID 142033499
4-[2-(4-fluorophenyl)sulfanylethyl]-1-[[(1R)-3-methylcyclopentyl]methyl]piperidine (PubChem CID 142033499) has the molecular formula C20H30FNS and a molecular weight of 335.53 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)sulfanylethyl]-1-[[(1R)-3-methylcyclopentyl]methyl]piperidine.
| Compound Name | 4-[2-(4-fluorophenyl)sulfanylethyl]-1-[[(1R)-3-methylcyclopentyl]methyl]piperidine |
|---|---|
| PubChem CID | 142033499 |
| Molecular Formula | C20H30FNS |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[2-(4-fluorophenyl)sulfanylethyl]-1-[[(1R)-3-methylcyclopentyl]methyl]piperidine |
| SMILES | CC1CC[C@@H](CN2CCC(CCSc3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C20H30FNS/c1-16-2-3-18(14-16)15-22-11-8-17(9-12-22)10-13-23-20-6-4-19(21)5-7-20/h4-7,16-18H,2-3,8-15H2,1H3/t16?,18-/m1/s1 |
| InChIKey | DOWYRMXOGLNNKS-UHUGOGIASA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |