About methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one
methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one (PubChem CID 142033717) has the molecular formula C11H22O2
and a molecular weight of 186.30 g/mol. Its IUPAC name is methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one.
Molecular Properties
| Compound Name | methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one |
| PubChem CID | 142033717 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one |
| SMILES | C.CC(C)=O.C[C@@H]1CCC(C=O)C1 |
| InChI | InChI=1S/C7H12O.C3H6O.CH4/c1-6-2-3-7(4-6)5-8;1-3(2)4;/h5-7H,2-4H2,1H3;1-2H3;1H4/t6-,7?;;/m1../s1 |
| InChIKey | TVEWDHXXIICDOV-DKPBNVODSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one?
The IUPAC name of methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one (CID 142033717) is methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one.
What is the SMILES notation for methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one?
The canonical SMILES for methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one is C.CC(C)=O.C[C@@H]1CCC(C=O)C1.
What is the InChIKey of methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one?
The InChIKey is TVEWDHXXIICDOV-DKPBNVODSA-N. The full InChI is InChI=1S/C7H12O.C3H6O.CH4/c1-6-2-3-7(4-6)5-8;1-3(2)4;/h5-7H,2-4H2,1H3;1-2H3;1H4/t6-,7?;;/m1../s1.
What are the key properties of methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one?
methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one has a molecular weight of 186.30 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(3R)-3-methylcyclopentane-1-carbaldehyde;propan-2-one is sourced from PubChem (CID 142033717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).