C15H12BrF2NO2 — CID 142035556
3-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-methylbenzamide (PubChem CID 142035556) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-methylbenzamide.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 142035556 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(O)c(Cc2ccc(Br)cc2F)c1F |
| InChI | InChI=1S/C15H12BrF2NO2/c1-7-4-11(15(19)21)14(20)10(13(7)18)5-8-2-3-9(16)6-12(8)17/h2-4,6,20H,5H2,1H3,(H2,19,21) |
| InChIKey | CSNCWCRQPUGWCG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |