C17H18ClNO3P2 — CID 142035566
3-[2-[[3,5-bis(phosphanyl)phenyl]methylcarbamoyl]-5-chlorophenyl]propanoic acid (PubChem CID 142035566) has the molecular formula C17H18ClNO3P2 and a molecular weight of 381.74 g/mol. Its IUPAC name is 3-[2-[[3,5-bis(phosphanyl)phenyl]methylcarbamoyl]-5-chlorophenyl]propanoic acid.
| Compound Name | 3-[2-[[3,5-bis(phosphanyl)phenyl]methylcarbamoyl]-5-chlorophenyl]propanoic acid |
|---|---|
| PubChem CID | 142035566 |
| Molecular Formula | C17H18ClNO3P2 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-[2-[[3,5-bis(phosphanyl)phenyl]methylcarbamoyl]-5-chlorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(Cl)ccc1C(=O)NCc1cc(P)cc(P)c1 |
| InChI | InChI=1S/C17H18ClNO3P2/c18-12-2-3-15(11(7-12)1-4-16(20)21)17(22)19-9-10-5-13(23)8-14(24)6-10/h2-3,5-8H,1,4,9,23-24H2,(H,19,22)(H,20,21) |
| InChIKey | HPCYYXWNIUTALL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|