C9H10ClO5P — CID 150711001
3-(5-chloro-2-phosphonophenyl)propanoic acid (PubChem CID 150711001) has the molecular formula C9H10ClO5P and a molecular weight of 264.60 g/mol. Its IUPAC name is 3-(5-chloro-2-phosphonophenyl)propanoic acid.
| Compound Name | 3-(5-chloro-2-phosphonophenyl)propanoic acid |
|---|---|
| PubChem CID | 150711001 |
| Molecular Formula | C9H10ClO5P |
| Molecular Weight | 264.60 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3-(5-chloro-2-phosphonophenyl)propanoic acid |
| SMILES | O=C(O)CCc1cc(Cl)ccc1P(=O)(O)O |
| InChI | InChI=1S/C9H10ClO5P/c10-7-2-3-8(16(13,14)15)6(5-7)1-4-9(11)12/h2-3,5H,1,4H2,(H,11,12)(H2,13,14,15) |
| InChIKey | JNWMXAPEFNYSIG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|