C18H31N5O2 — CID 142036004
2-[(2-aminoacetyl)amino]-N-[2-(2-methylpentylamino)ethyl]-3-pyridin-4-ylpropanamide (PubChem CID 142036004) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-N-[2-(2-methylpentylamino)ethyl]-3-pyridin-4-ylpropanamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-N-[2-(2-methylpentylamino)ethyl]-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 142036004 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-N-[2-(2-methylpentylamino)ethyl]-3-pyridin-4-ylpropanamide |
| SMILES | CCCC(C)CNCCNC(=O)C(Cc1ccncc1)NC(=O)CN |
| InChI | InChI=1S/C18H31N5O2/c1-3-4-14(2)13-21-9-10-22-18(25)16(23-17(24)12-19)11-15-5-7-20-8-6-15/h5-8,14,16,21H,3-4,9-13,19H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | LYMFOEAXJHMJPK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|