C20H26ClN5O2 — CID 59985718
(2S)-2-amino-3-(4-chlorophenyl)-N-[(2S)-1-[2-(methylamino)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]propanamide (PubChem CID 59985718) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-chlorophenyl)-N-[(2S)-1-[2-(methylamino)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[(2S)-1-[2-(methylamino)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]propanamide |
|---|---|
| PubChem CID | 59985718 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[(2S)-1-[2-(methylamino)ethylamino]-1-oxo-3-pyridin-4-ylpropan-2-yl]propanamide |
| SMILES | CNCCNC(=O)[C@H](Cc1ccncc1)NC(=O)[C@@H](N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-23-10-11-25-20(28)18(13-15-6-8-24-9-7-15)26-19(27)17(22)12-14-2-4-16(21)5-3-14/h2-9,17-18,23H,10-13,22H2,1H3,(H,25,28)(H,26,27)/t17-,18-/m0/s1 |
| InChIKey | YFCNULKWJGMRJH-ROUUACIJSA-N |
| XLogP | 0.67 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|