C33H38N4O7 — CID 142036177
4-[[1-[2-[3-butan-2-yl-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidin-2-yl]methoxy]-2-methyl-3-nitrobenzoic acid (PubChem CID 142036177) has the molecular formula C33H38N4O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is 4-[[1-[2-[3-butan-2-yl-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidin-2-yl]methoxy]-2-methyl-3-nitrobenzoic acid.
| Compound Name | 4-[[1-[2-[3-butan-2-yl-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidin-2-yl]methoxy]-2-methyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 142036177 |
| Molecular Formula | C33H38N4O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 4-[[1-[2-[3-butan-2-yl-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidin-2-yl]methoxy]-2-methyl-3-nitrobenzoic acid |
| SMILES | CCC(C)c1cc(CC(=O)N2CCCC2COc2ccc(C(=O)O)c(C)c2[N+](=O)[O-])ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C33H38N4O7/c1-5-20(2)26-17-23(12-14-28(26)35-33(41)34-27-11-7-6-9-21(27)3)18-30(38)36-16-8-10-24(36)19-44-29-15-13-25(32(39)40)22(4)31(29)37(42)43/h6-7,9,11-15,17,20,24H,5,8,10,16,18-19H2,1-4H3,(H,39,40)(H2,34,35,41) |
| InChIKey | MUEQWHXITDTMCX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|