C26H28O3 — CID 142038388
5-methylidene-3a-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylmethoxy)phenyl]methyl]-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 142038388) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-methylidene-3a-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylmethoxy)phenyl]methyl]-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 5-methylidene-3a-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylmethoxy)phenyl]methyl]-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 142038388 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-methylidene-3a-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylmethoxy)phenyl]methyl]-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(OCc3ccc4c(c3)CCCC4)cc2)C1 |
| InChI | InChI=1S/C26H28O3/c1-18-12-23-17-29-25(27)26(23,14-18)15-19-7-10-24(11-8-19)28-16-20-6-9-21-4-2-3-5-22(21)13-20/h6-11,13,23H,1-5,12,14-17H2 |
| InChIKey | UYIAZCVAIMQPSJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|