C20H24O4 — CID 23392316
[3-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 23392316) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is [3-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23392316 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [3-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C1CC2COC(=O)C2(Cc2cccc(OC(=O)C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C20H24O4/c1-13-8-15-12-23-18(22)20(15,10-13)11-14-6-5-7-16(9-14)24-17(21)19(2,3)4/h5-7,9,15H,1,8,10-12H2,2-4H3 |
| InChIKey | XKTBTWLBVHAYBW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|