C25H34N2O4S — CID 142038685
ethane;3-pyridin-3-ylpropyl 6-(3,3-dimethyl-2-oxopentanoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-5-carboxylate (PubChem CID 142038685) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is ethane;3-pyridin-3-ylpropyl 6-(3,3-dimethyl-2-oxopentanoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-5-carboxylate.
| Compound Name | ethane;3-pyridin-3-ylpropyl 6-(3,3-dimethyl-2-oxopentanoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 142038685 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethane;3-pyridin-3-ylpropyl 6-(3,3-dimethyl-2-oxopentanoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-5-carboxylate |
| SMILES | CC.CCC(C)(C)C(=O)C(=O)N1Cc2sccc2CC1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C23H28N2O4S.C2H6/c1-4-23(2,3)20(26)21(27)25-15-19-17(9-12-30-19)13-18(25)22(28)29-11-6-8-16-7-5-10-24-14-16;1-2/h5,7,9-10,12,14,18H,4,6,8,11,13,15H2,1-3H3;1-2H3 |
| InChIKey | BEEULYRGDYSQJR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|