C15H22N6O3 — CID 142039095
2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxopropyl)butanamide (PubChem CID 142039095) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxopropyl)butanamide.
| Compound Name | 2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxopropyl)butanamide |
|---|---|
| PubChem CID | 142039095 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxopropyl)butanamide |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NCC(C)=O)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C15H22N6O3/c1-4-12(14(23)20-7-9(2)22)21-6-5-18-13(15(21)24)19-8-11(17)10(3)16/h5-6,12,16-17H,4,7-8H2,1-3H3,(H,18,19)(H,20,23)/b16-10+,17-11- |
| InChIKey | UZSNKIVIAQJFHM-VUTUTYQISA-N |
| XLogP | 0.37 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|