About ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine
ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine (PubChem CID 142040832) has the molecular formula C12H31N3
and a molecular weight of 217.40 g/mol. Its IUPAC name is ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine |
| PubChem CID | 142040832 |
| Molecular Formula | C12H31N3 |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.25 |
| IUPAC Name | ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine |
| SMILES | CC.CN.CNCC1CCCC(CN)C1 |
| InChI | InChI=1S/C9H20N2.C2H6.CH5N/c1-11-7-9-4-2-3-8(5-9)6-10;2*1-2/h8-9,11H,2-7,10H2,1H3;1-2H3;2H2,1H3 |
| InChIKey | OCLIQYMBLQFIDW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine?
The IUPAC name of ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine (CID 142040832) is ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine.
What is the SMILES notation for ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine?
The canonical SMILES for ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine is CC.CN.CNCC1CCCC(CN)C1.
What is the InChIKey of ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine?
The InChIKey is OCLIQYMBLQFIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.C2H6.CH5N/c1-11-7-9-4-2-3-8(5-9)6-10;2*1-2/h8-9,11H,2-7,10H2,1H3;1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine?
ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine has a molecular weight of 217.40 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;[3-(methylaminomethyl)cyclohexyl]methanamine is sourced from PubChem (CID 142040832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).