C8H17NO — CID 124563459
[(1R,3R)-3-(aminomethyl)cyclohexyl]methanol (PubChem CID 124563459) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is [(1R,3R)-3-(aminomethyl)cyclohexyl]methanol.
| Compound Name | [(1R,3R)-3-(aminomethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 124563459 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | [(1R,3R)-3-(aminomethyl)cyclohexyl]methanol |
| SMILES | NC[C@@H]1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C8H17NO/c9-5-7-2-1-3-8(4-7)6-10/h7-8,10H,1-6,9H2/t7-,8-/m1/s1 |
| InChIKey | OZWKJPQKSZQGOJ-HTQZYQBOSA-N |
| XLogP | 0.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |