C9H18N2O2 — CID 130921204
[(1S,3R)-3-(hydroxymethyl)cyclohexyl]methylurea (PubChem CID 130921204) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is [(1S,3R)-3-(hydroxymethyl)cyclohexyl]methylurea.
| Compound Name | [(1S,3R)-3-(hydroxymethyl)cyclohexyl]methylurea |
|---|---|
| PubChem CID | 130921204 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [(1S,3R)-3-(hydroxymethyl)cyclohexyl]methylurea |
| SMILES | NC(=O)NC[C@H]1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C9H18N2O2/c10-9(13)11-5-7-2-1-3-8(4-7)6-12/h7-8,12H,1-6H2,(H3,10,11,13)/t7-,8+/m0/s1 |
| InChIKey | HHTINEWBBDCYBE-JGVFFNPUSA-N |
| XLogP | 0.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |