C19H36N4O3 — CID 142041945
ethane;(9S)-9-methyl-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione;propane (PubChem CID 142041945) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethane;(9S)-9-methyl-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione;propane.
| Compound Name | ethane;(9S)-9-methyl-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione;propane |
|---|---|
| PubChem CID | 142041945 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | ethane;(9S)-9-methyl-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione;propane |
| SMILES | C=C1CNC(=O)CNC(=O)[C@H](C)NC(=O)C2CCCCN12.CC.CCC |
| InChI | InChI=1S/C14H22N4O3.C3H8.C2H6/c1-9-7-15-12(19)8-16-13(20)10(2)17-14(21)11-5-3-4-6-18(9)11;1-3-2;1-2/h10-11H,1,3-8H2,2H3,(H,15,19)(H,16,20)(H,17,21);3H2,1-2H3;1-2H3/t10-,11?;;/m0../s1 |
| InChIKey | YFVQDURCNOVBPR-KXQUXSGXSA-N |
| XLogP | 1.55 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |