About ethane;2-(2-methylphenyl)phenol;propane
ethane;2-(2-methylphenyl)phenol;propane (PubChem CID 142042568) has the molecular formula C20H32O
and a molecular weight of 288.48 g/mol. Its IUPAC name is ethane;2-(2-methylphenyl)phenol;propane.
Molecular Properties
| Compound Name | ethane;2-(2-methylphenyl)phenol;propane |
| PubChem CID | 142042568 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | ethane;2-(2-methylphenyl)phenol;propane |
| SMILES | CC.CC.CCC.Cc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/C13H12O.C3H8.2C2H6/c1-10-6-2-3-7-11(10)12-8-4-5-9-13(12)14;1-3-2;2*1-2/h2-9,14H,1H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | SODPBKTWDAPIBV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-(2-methylphenyl)phenol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methylphenyl)phenol;propane?
The IUPAC name of ethane;2-(2-methylphenyl)phenol;propane (CID 142042568) is ethane;2-(2-methylphenyl)phenol;propane.
What is the SMILES notation for ethane;2-(2-methylphenyl)phenol;propane?
The canonical SMILES for ethane;2-(2-methylphenyl)phenol;propane is CC.CC.CCC.Cc1ccccc1-c1ccccc1O.
What is the InChIKey of ethane;2-(2-methylphenyl)phenol;propane?
The InChIKey is SODPBKTWDAPIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C3H8.2C2H6/c1-10-6-2-3-7-11(10)12-8-4-5-9-13(12)14;1-3-2;2*1-2/h2-9,14H,1H3;3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-(2-methylphenyl)phenol;propane?
ethane;2-(2-methylphenyl)phenol;propane has a molecular weight of 288.48 g/mol, XLogP of 6.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methylphenyl)phenol;propane is sourced from PubChem (CID 142042568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).