About N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane
N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane (PubChem CID 142042743) has the molecular formula C11H18FNOS
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane.
Molecular Properties
| Compound Name | N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane |
| PubChem CID | 142042743 |
| Molecular Formula | C11H18FNOS |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane |
| SMILES | C=S(=O)(NC)c1ccccc1F.CCC |
| InChI | InChI=1S/C8H10FNOS.C3H8/c1-10-12(2,11)8-6-4-3-5-7(8)9;1-3-2/h3-6H,2H2,1H3,(H,10,11);3H2,1-2H3 |
| InChIKey | WZNXKDNNJPHQKY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane?
The IUPAC name of N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane (CID 142042743) is N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane.
What is the SMILES notation for N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane?
The canonical SMILES for N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane is C=S(=O)(NC)c1ccccc1F.CCC.
What is the InChIKey of N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane?
The InChIKey is WZNXKDNNJPHQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNOS.C3H8/c1-10-12(2,11)8-6-4-3-5-7(8)9;1-3-2/h3-6H,2H2,1H3,(H,10,11);3H2,1-2H3.
What are the key properties of N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane?
N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane has a molecular weight of 231.34 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-fluorophenyl)-methylidene-oxo-λ6-sulfanyl]methanamine;propane is sourced from PubChem (CID 142042743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).