C20H13ClN4O3S — CID 1420431
3-chloro-N-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 1420431) has the molecular formula C20H13ClN4O3S and a molecular weight of 424.87 g/mol. Its IUPAC name is 3-chloro-N-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1420431 |
| Molecular Formula | C20H13ClN4O3S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 3-chloro-N-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1cccn1-c1ccc([N+](=O)[O-])cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H13ClN4O3S/c21-18-16-5-1-2-6-17(16)29-19(18)20(26)23-22-12-15-4-3-11-24(15)13-7-9-14(10-8-13)25(27)28/h1-12H,(H,23,26) |
| InChIKey | MSXQMOXLKHESCY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|