C15H20N2O — CID 142044368
N-[3-[(3E)-4-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-methylacetamide (PubChem CID 142044368) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[3-[(3E)-4-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-methylacetamide.
| Compound Name | N-[3-[(3E)-4-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 142044368 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[3-[(3E)-4-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-N-methylacetamide |
| SMILES | C=C(/C=C/N(C)C)c1cccc(N(C)C(C)=O)c1 |
| InChI | InChI=1S/C15H20N2O/c1-12(9-10-16(3)4)14-7-6-8-15(11-14)17(5)13(2)18/h6-11H,1H2,2-5H3/b10-9+ |
| InChIKey | AUPPOTHAQANYSA-MDZDMXLPSA-N |
| XLogP | 2.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|