C19H12BF3N2O3 — CID 142045984
CID 142045984 (PubChem CID 142045984) has the molecular formula C19H12BF3N2O3 and a molecular weight of 384.12 g/mol.
| Compound Name | CID 142045984 |
|---|---|
| PubChem CID | 142045984 |
| Molecular Formula | C19H12BF3N2O3 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(O)c(C(=O)Nc2ccccc2Oc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H12BF3N2O3/c20-16-9-8-14(26)17(25-16)18(27)24-13-6-1-2-7-15(13)28-12-5-3-4-11(10-12)19(21,22)23/h1-10,26H,(H,24,27) |
| InChIKey | MGQXBBWETKUPAH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|