About CID 142046589
CID 142046589 (PubChem CID 142046589) has the molecular formula C7H13BN2O2
and a molecular weight of 168.01 g/mol.
Molecular Properties
| Compound Name | CID 142046589 |
| PubChem CID | 142046589 |
| Molecular Formula | C7H13BN2O2 |
| Molecular Weight | 168.01 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CC=O)CCNC |
| InChI | InChI=1S/C7H13BN2O2/c1-9-2-3-10(4-5-11)7(12)6-8/h5,9H,2-4,6H2,1H3 |
| InChIKey | HRAOEGQYNKJNFR-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.01 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142046589 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142046589?
The IUPAC name of CID 142046589 (CID 142046589) is not available.
What is the SMILES notation for CID 142046589?
The canonical SMILES for CID 142046589 is [B]CC(=O)N(CC=O)CCNC.
What is the InChIKey of CID 142046589?
The InChIKey is HRAOEGQYNKJNFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BN2O2/c1-9-2-3-10(4-5-11)7(12)6-8/h5,9H,2-4,6H2,1H3.
What are the key properties of CID 142046589?
CID 142046589 has a molecular weight of 168.01 g/mol, XLogP of -1.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142046589 is sourced from PubChem (CID 142046589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).